C24H32N4O2 — CID 21073663
7-[4-[4-(3-ethylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 21073663) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 7-[4-[4-(3-ethylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-[4-[4-(3-ethylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 21073663 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 7-[4-[4-(3-ethylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | CCc1cccc(N2CCN(CCCCOc3ccc4c(n3)NC(=O)CC4)CC2)c1 |
| InChI | InChI=1S/C24H32N4O2/c1-2-19-6-5-7-21(18-19)28-15-13-27(14-16-28)12-3-4-17-30-23-11-9-20-8-10-22(29)25-24(20)26-23/h5-7,9,11,18H,2-4,8,10,12-17H2,1H3,(H,25,26,29) |
| InChIKey | LHJIWCQMHBHQNF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|