C25H31Cl2N3O2 — CID 147533941
4-(aminomethyl)-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 147533941) has the molecular formula C25H31Cl2N3O2 and a molecular weight of 476.45 g/mol. Its IUPAC name is 4-(aminomethyl)-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 4-(aminomethyl)-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 147533941 |
| Molecular Formula | C25H31Cl2N3O2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-(aminomethyl)-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | NCC1CC(=O)Cc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc21 |
| InChI | InChI=1S/C25H31Cl2N3O2/c26-23-4-3-5-24(25(23)27)30-11-9-29(10-12-30)8-1-2-13-32-21-6-7-22-18(16-21)14-20(31)15-19(22)17-28/h3-7,16,19H,1-2,8-15,17,28H2 |
| InChIKey | FNPBBWQCCLPJNU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|