C30H38Cl2N4O5 — CID 91326922
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydro-1H-quinolin-3-yl]methyl 4-acetamidobutanoate (PubChem CID 91326922) has the molecular formula C30H38Cl2N4O5 and a molecular weight of 605.56 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydro-1H-quinolin-3-yl]methyl 4-acetamidobutanoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydro-1H-quinolin-3-yl]methyl 4-acetamidobutanoate |
|---|---|
| PubChem CID | 91326922 |
| Molecular Formula | C30H38Cl2N4O5 |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydro-1H-quinolin-3-yl]methyl 4-acetamidobutanoate |
| SMILES | CC(=O)NCCCC(=O)OCC1Cc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2NC1=O |
| InChI | InChI=1S/C30H38Cl2N4O5/c1-21(37)33-11-5-8-28(38)41-20-23-18-22-9-10-24(19-26(22)34-30(23)39)40-17-3-2-12-35-13-15-36(16-14-35)27-7-4-6-25(31)29(27)32/h4,6-7,9-10,19,23H,2-3,5,8,11-18,20H2,1H3,(H,33,37)(H,34,39) |
| InChIKey | RMLVUWHXHYSJOP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|