C26H30Cl2N4O5 — CID 155445169
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl methylamino carbonate (PubChem CID 155445169) has the molecular formula C26H30Cl2N4O5 and a molecular weight of 549.46 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl methylamino carbonate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl methylamino carbonate |
|---|---|
| PubChem CID | 155445169 |
| Molecular Formula | C26H30Cl2N4O5 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl methylamino carbonate |
| SMILES | CNOC(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C26H30Cl2N4O5/c1-29-37-26(34)36-18-32-23-17-20(9-7-19(23)8-10-24(32)33)35-16-3-2-11-30-12-14-31(15-13-30)22-6-4-5-21(27)25(22)28/h4-10,17,29H,2-3,11-16,18H2,1H3 |
| InChIKey | AOKWMEXHKZOWOH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|