C28H33Cl2N5O4 — CID 56596645
2-amino-N-[1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-1-oxopropan-2-yl]acetamide (PubChem CID 56596645) has the molecular formula C28H33Cl2N5O4 and a molecular weight of 574.51 g/mol. Its IUPAC name is 2-amino-N-[1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-1-oxopropan-2-yl]acetamide.
| Compound Name | 2-amino-N-[1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-1-oxopropan-2-yl]acetamide |
|---|---|
| PubChem CID | 56596645 |
| Molecular Formula | C28H33Cl2N5O4 |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 2-amino-N-[1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-1-oxopropan-2-yl]acetamide |
| SMILES | CC(NC(=O)CN)C(=O)n1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C28H33Cl2N5O4/c1-19(32-25(36)18-31)28(38)35-24-17-21(9-7-20(24)8-10-26(35)37)39-16-3-2-11-33-12-14-34(15-13-33)23-6-4-5-22(29)27(23)30/h4-10,17,19H,2-3,11-16,18,31H2,1H3,(H,32,36) |
| InChIKey | MUUFMXWDUKEGEJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|