C28H33Cl2N3O5 — CID 58579116
7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1-[2-(2-methoxyethoxy)acetyl]quinolin-2-one (PubChem CID 58579116) has the molecular formula C28H33Cl2N3O5 and a molecular weight of 562.49 g/mol. Its IUPAC name is 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1-[2-(2-methoxyethoxy)acetyl]quinolin-2-one.
| Compound Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1-[2-(2-methoxyethoxy)acetyl]quinolin-2-one |
|---|---|
| PubChem CID | 58579116 |
| Molecular Formula | C28H33Cl2N3O5 |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1-[2-(2-methoxyethoxy)acetyl]quinolin-2-one |
| SMILES | COCCOCC(=O)n1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C28H33Cl2N3O5/c1-36-17-18-37-20-27(35)33-25-19-22(9-7-21(25)8-10-26(33)34)38-16-3-2-11-31-12-14-32(15-13-31)24-6-4-5-23(29)28(24)30/h4-10,19H,2-3,11-18,20H2,1H3 |
| InChIKey | HGSNHRYLKHPLGA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|