C31H37Cl2N3O4 — CID 58097028
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl cyclohexanecarboxylate (PubChem CID 58097028) has the molecular formula C31H37Cl2N3O4 and a molecular weight of 586.56 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl cyclohexanecarboxylate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 58097028 |
| Molecular Formula | C31H37Cl2N3O4 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl cyclohexanecarboxylate |
| SMILES | O=C(OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21)C1CCCCC1 |
| InChI | InChI=1S/C31H37Cl2N3O4/c32-26-9-6-10-27(30(26)33)35-18-16-34(17-19-35)15-4-5-20-39-25-13-11-23-12-14-29(37)36(28(23)21-25)22-40-31(38)24-7-2-1-3-8-24/h6,9-14,21,24H,1-5,7-8,15-20,22H2 |
| InChIKey | BBGSEPQAUZDTFA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|