C31H39Cl2N3O4 — CID 58096710
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl cyclohexanecarboxylate (PubChem CID 58096710) has the molecular formula C31H39Cl2N3O4 and a molecular weight of 588.58 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl cyclohexanecarboxylate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 58096710 |
| Molecular Formula | C31H39Cl2N3O4 |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl cyclohexanecarboxylate |
| SMILES | O=C(OCOC1=Nc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc2CC1)C1CCCCC1 |
| InChI | InChI=1S/C31H39Cl2N3O4/c32-26-9-6-10-28(30(26)33)36-18-16-35(17-19-36)15-4-5-20-38-25-13-11-23-12-14-29(34-27(23)21-25)39-22-40-31(37)24-7-2-1-3-8-24/h6,9-11,13,21,24H,1-5,7-8,12,14-20,22H2 |
| InChIKey | TUPDTCZYIWVDGH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|