C45H59Cl2N3O4 — CID 76666337
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl henicosa-5,8,11,14,17-pentaenoate (PubChem CID 76666337) has the molecular formula C45H59Cl2N3O4 and a molecular weight of 776.89 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl henicosa-5,8,11,14,17-pentaenoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl henicosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 76666337 |
| Molecular Formula | C45H59Cl2N3O4 |
| Molecular Weight | 776.89 g/mol |
| Exact Mass | 775.39 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl henicosa-5,8,11,14,17-pentaenoate |
| SMILES | CCCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCOC1=Nc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc2CC1 |
| InChI | InChI=1S/C45H59Cl2N3O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-44(51)54-37-53-43-29-27-38-26-28-39(36-41(38)48-43)52-35-21-20-30-49-31-33-50(34-32-49)42-24-22-23-40(46)45(42)47/h4-5,7-8,10-11,13-14,16-17,22-24,26,28,36H,2-3,6,9,12,15,18-21,25,27,29-35,37H2,1H3 |
| InChIKey | YYKSVVVTQCCLKV-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.89 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|