C29H38ClIN4O4 — CID 166691113
[7-[4-[4-(2-chloro-3-iodophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl N,N-diethylcarbamate (PubChem CID 166691113) has the molecular formula C29H38ClIN4O4 and a molecular weight of 669.00 g/mol. Its IUPAC name is [7-[4-[4-(2-chloro-3-iodophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl N,N-diethylcarbamate.
| Compound Name | [7-[4-[4-(2-chloro-3-iodophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 166691113 |
| Molecular Formula | C29H38ClIN4O4 |
| Molecular Weight | 669.00 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | [7-[4-[4-(2-chloro-3-iodophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCOC1=Nc2cc(OCCCCN3CCN(c4cccc(I)c4Cl)CC3)ccc2CC1 |
| InChI | InChI=1S/C29H38ClIN4O4/c1-3-34(4-2)29(36)39-21-38-27-13-11-22-10-12-23(20-25(22)32-27)37-19-6-5-14-33-15-17-35(18-16-33)26-9-7-8-24(31)28(26)30/h7-10,12,20H,3-6,11,13-19,21H2,1-2H3 |
| InChIKey | PBDRNUNLHOYECY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.00 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|