C31H33Cl2N3O3 — CID 56596851
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] 2-phenylacetate (PubChem CID 56596851) has the molecular formula C31H33Cl2N3O3 and a molecular weight of 566.53 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] 2-phenylacetate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 56596851 |
| Molecular Formula | C31H33Cl2N3O3 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OC1=Nc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc2CC1 |
| InChI | InChI=1S/C31H33Cl2N3O3/c32-26-9-6-10-28(31(26)33)36-18-16-35(17-19-36)15-4-5-20-38-25-13-11-24-12-14-29(34-27(24)22-25)39-30(37)21-23-7-2-1-3-8-23/h1-3,6-11,13,22H,4-5,12,14-21H2 |
| InChIKey | PJDZSFXOEUMNPI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|