C42H57Cl2N3O4 — CID 76666373
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl octadeca-9,12,15-trienoate (PubChem CID 76666373) has the molecular formula C42H57Cl2N3O4 and a molecular weight of 738.84 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl octadeca-9,12,15-trienoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 76666373 |
| Molecular Formula | C42H57Cl2N3O4 |
| Molecular Weight | 738.84 g/mol |
| Exact Mass | 737.37 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl octadeca-9,12,15-trienoate |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)OCOC1=Nc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc2CC1 |
| InChI | InChI=1S/C42H57Cl2N3O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-41(48)51-34-50-40-26-24-35-23-25-36(33-38(35)45-40)49-32-18-17-27-46-28-30-47(31-29-46)39-21-19-20-37(43)42(39)44/h3-4,6-7,9-10,19-21,23,25,33H,2,5,8,11-18,22,24,26-32,34H2,1H3 |
| InChIKey | SVHYDKKQIKBKHK-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.84 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|