C24H29Cl2N3O6 — CID 66616284
ethyl 2-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-nitrophenoxy]acetate (PubChem CID 66616284) has the molecular formula C24H29Cl2N3O6 and a molecular weight of 526.42 g/mol. Its IUPAC name is ethyl 2-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-nitrophenoxy]acetate.
| Compound Name | ethyl 2-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 66616284 |
| Molecular Formula | C24H29Cl2N3O6 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | ethyl 2-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-nitrophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(OCCCCN2CCN(c3cccc(Cl)c3Cl)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H29Cl2N3O6/c1-2-33-23(30)17-35-22-9-8-18(16-21(22)29(31)32)34-15-4-3-10-27-11-13-28(14-12-27)20-7-5-6-19(25)24(20)26/h5-9,16H,2-4,10-15,17H2,1H3 |
| InChIKey | WMGKQUMNTOBWKX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 94.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|