C27H33Cl2N3O3 — CID 56596826
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] butanoate (PubChem CID 56596826) has the molecular formula C27H33Cl2N3O3 and a molecular weight of 518.49 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] butanoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] butanoate |
|---|---|
| PubChem CID | 56596826 |
| Molecular Formula | C27H33Cl2N3O3 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] butanoate |
| SMILES | CCCC(=O)OC1=Nc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc2CC1 |
| InChI | InChI=1S/C27H33Cl2N3O3/c1-2-6-26(33)35-25-12-10-20-9-11-21(19-23(20)30-25)34-18-4-3-13-31-14-16-32(17-15-31)24-8-5-7-22(28)27(24)29/h5,7-9,11,19H,2-4,6,10,12-18H2,1H3 |
| InChIKey | XMSQRKNYWQJFIU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|