C32H43Cl2N3O3 — CID 130218410
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] 3-ethyl-5-methylhexanoate (PubChem CID 130218410) has the molecular formula C32H43Cl2N3O3 and a molecular weight of 588.62 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] 3-ethyl-5-methylhexanoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] 3-ethyl-5-methylhexanoate |
|---|---|
| PubChem CID | 130218410 |
| Molecular Formula | C32H43Cl2N3O3 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl] 3-ethyl-5-methylhexanoate |
| SMILES | CCC(CC(=O)OC1=Nc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc2CC1)CC(C)C |
| InChI | InChI=1S/C32H43Cl2N3O3/c1-4-24(20-23(2)3)21-31(38)40-30-13-11-25-10-12-26(22-28(25)35-30)39-19-6-5-14-36-15-17-37(18-16-36)29-9-7-8-27(33)32(29)34/h7-10,12,22-24H,4-6,11,13-21H2,1-3H3 |
| InChIKey | KYRIIQPRRKBCRD-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|