C31H41Cl2N3O4 — CID 58097023
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl heptanoate (PubChem CID 58097023) has the molecular formula C31H41Cl2N3O4 and a molecular weight of 590.59 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl heptanoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl heptanoate |
|---|---|
| PubChem CID | 58097023 |
| Molecular Formula | C31H41Cl2N3O4 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydroquinolin-2-yl]oxymethyl heptanoate |
| SMILES | CCCCCCC(=O)OCOC1=Nc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc2CC1 |
| InChI | InChI=1S/C31H41Cl2N3O4/c1-2-3-4-5-11-30(37)40-23-39-29-15-13-24-12-14-25(22-27(24)34-29)38-21-7-6-16-35-17-19-36(20-18-35)28-10-8-9-26(32)31(28)33/h8-10,12,14,22H,2-7,11,13,15-21,23H2,1H3 |
| InChIKey | DPLRILZIQJXPPZ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|