C27H32Cl2N4O3 — CID 66810506
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] N-propylcarbamate (PubChem CID 66810506) has the molecular formula C27H32Cl2N4O3 and a molecular weight of 531.48 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] N-propylcarbamate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 66810506 |
| Molecular Formula | C27H32Cl2N4O3 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2n1 |
| InChI | InChI=1S/C27H32Cl2N4O3/c1-2-12-30-27(34)36-25-11-9-20-8-10-21(19-23(20)31-25)35-18-4-3-13-32-14-16-33(17-15-32)24-7-5-6-22(28)26(24)29/h5-11,19H,2-4,12-18H2,1H3,(H,30,34) |
| InChIKey | UNAQVVDREACFIO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|