C31H36N4O3S — CID 89435244
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] piperidine-1-carboxylate (PubChem CID 89435244) has the molecular formula C31H36N4O3S and a molecular weight of 544.72 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] piperidine-1-carboxylate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89435244 |
| Molecular Formula | C31H36N4O3S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc2n1)N1CCCCC1 |
| InChI | InChI=1S/C31H36N4O3S/c36-31(35-15-2-1-3-16-35)38-30-12-10-24-9-11-25(23-27(24)32-30)37-21-5-4-14-33-17-19-34(20-18-33)28-7-6-8-29-26(28)13-22-39-29/h6-13,22-23H,1-5,14-21H2 |
| InChIKey | ZRCJBSXDVPLCQK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|