C28H30IN3O3S — CID 121275605
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] 2-iodopropanoate (PubChem CID 121275605) has the molecular formula C28H30IN3O3S and a molecular weight of 615.54 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] 2-iodopropanoate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] 2-iodopropanoate |
|---|---|
| PubChem CID | 121275605 |
| Molecular Formula | C28H30IN3O3S |
| Molecular Weight | 615.54 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] 2-iodopropanoate |
| SMILES | CC(I)C(=O)Oc1ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc2n1 |
| InChI | InChI=1S/C28H30IN3O3S/c1-20(29)28(33)35-27-10-8-21-7-9-22(19-24(21)30-27)34-17-3-2-12-31-13-15-32(16-14-31)25-5-4-6-26-23(25)11-18-36-26/h4-11,18-20H,2-3,12-17H2,1H3 |
| InChIKey | RTBULYBBEDSCFS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|