C33H33N3O3S — CID 138676872
2-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]-2-phenylacetic acid (PubChem CID 138676872) has the molecular formula C33H33N3O3S and a molecular weight of 551.71 g/mol. Its IUPAC name is 2-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]-2-phenylacetic acid.
| Compound Name | 2-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 138676872 |
| Molecular Formula | C33H33N3O3S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 2-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)c1ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc2n1 |
| InChI | InChI=1S/C33H33N3O3S/c37-33(38)32(25-7-2-1-3-8-25)28-14-12-24-11-13-26(23-29(24)34-28)39-21-5-4-16-35-17-19-36(20-18-35)30-9-6-10-31-27(30)15-22-40-31/h1-3,6-15,22-23,32H,4-5,16-21H2,(H,37,38) |
| InChIKey | YTCZVMXLWTWFQW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|