C27H31N3O3S — CID 144550125
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] acetate;molecular hydrogen (PubChem CID 144550125) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] acetate;molecular hydrogen.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] acetate;molecular hydrogen |
|---|---|
| PubChem CID | 144550125 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl] acetate;molecular hydrogen |
| SMILES | CC(=O)Oc1ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc2n1.[H][H] |
| InChI | InChI=1S/C27H29N3O3S.H2/c1-20(31)33-27-10-8-21-7-9-22(19-24(21)28-27)32-17-3-2-12-29-13-15-30(16-14-29)25-5-4-6-26-23(25)11-18-34-26;/h4-11,18-19H,2-3,12-17H2,1H3;1H |
| InChIKey | MEAQEUCJIJEDNS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|