C21H27ClN4O2S — CID 57499624
1-[5-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-1-methylpyrazol-3-yl]ethanone;hydrochloride (PubChem CID 57499624) has the molecular formula C21H27ClN4O2S and a molecular weight of 434.99 g/mol. Its IUPAC name is 1-[5-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-1-methylpyrazol-3-yl]ethanone;hydrochloride.
| Compound Name | 1-[5-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-1-methylpyrazol-3-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 57499624 |
| Molecular Formula | C21H27ClN4O2S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[5-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-1-methylpyrazol-3-yl]ethanone;hydrochloride |
| SMILES | CC(=O)c1cc(OCCCN2CCN(c3cccc4sccc34)CC2)n(C)n1.Cl |
| InChI | InChI=1S/C21H26N4O2S.ClH/c1-16(26)18-15-21(23(2)22-18)27-13-4-8-24-9-11-25(12-10-24)19-5-3-6-20-17(19)7-14-28-20;/h3,5-7,14-15H,4,8-13H2,1-2H3;1H |
| InChIKey | CKHKQHIRMBVLBJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|