C20H29N3OS2 — CID 87693852
N-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]-N-ethyl-2-sulfanylacetamide (PubChem CID 87693852) has the molecular formula C20H29N3OS2 and a molecular weight of 391.61 g/mol. Its IUPAC name is N-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]-N-ethyl-2-sulfanylacetamide.
| Compound Name | N-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]-N-ethyl-2-sulfanylacetamide |
|---|---|
| PubChem CID | 87693852 |
| Molecular Formula | C20H29N3OS2 |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]-N-ethyl-2-sulfanylacetamide |
| SMILES | CCN(CCCCN1CCN(c2cccc3sccc23)CC1)C(=O)CS |
| InChI | InChI=1S/C20H29N3OS2/c1-2-22(20(24)16-25)10-4-3-9-21-11-13-23(14-12-21)18-6-5-7-19-17(18)8-15-26-19/h5-8,15,25H,2-4,9-14,16H2,1H3 |
| InChIKey | QBDRAOOFLISSEO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|