C22H32N6O2S — CID 66646027
3-[5-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methyl-1,2-dihydropyrazol-3-yl]-1,1-dimethylurea (PubChem CID 66646027) has the molecular formula C22H32N6O2S and a molecular weight of 444.61 g/mol. Its IUPAC name is 3-[5-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methyl-1,2-dihydropyrazol-3-yl]-1,1-dimethylurea.
| Compound Name | 3-[5-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methyl-1,2-dihydropyrazol-3-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 66646027 |
| Molecular Formula | C22H32N6O2S |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 3-[5-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methyl-1,2-dihydropyrazol-3-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1(C)C=C(OCCCN2CCN(c3cccc4sccc34)CC2)NN1 |
| InChI | InChI=1S/C22H32N6O2S/c1-22(23-21(29)26(2)3)16-20(24-25-22)30-14-5-9-27-10-12-28(13-11-27)18-6-4-7-19-17(18)8-15-31-19/h4,6-8,15-16,24-25H,5,9-14H2,1-3H3,(H,23,29) |
| InChIKey | VMVYXPLHCSOWJK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|