C22H30N2O3S — CID 57499606
4-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]cyclohexane-1-carboxylic acid (PubChem CID 57499606) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 4-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57499606 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 4-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(OCCCN2CCN(c3cccc4sccc34)CC2)CC1 |
| InChI | InChI=1S/C22H30N2O3S/c25-22(26)17-5-7-18(8-6-17)27-15-2-10-23-11-13-24(14-12-23)20-3-1-4-21-19(20)9-16-28-21/h1,3-4,9,16-18H,2,5-8,10-15H2,(H,25,26) |
| InChIKey | YGRNFJFBIRJMTB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|