C24H35ClIN3OS — CID 69099246
1-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]-3-(4-iodobutyl)pyrrolidin-2-one;hydrochloride (PubChem CID 69099246) has the molecular formula C24H35ClIN3OS and a molecular weight of 575.99 g/mol. Its IUPAC name is 1-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]-3-(4-iodobutyl)pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]-3-(4-iodobutyl)pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 69099246 |
| Molecular Formula | C24H35ClIN3OS |
| Molecular Weight | 575.99 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | 1-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]-3-(4-iodobutyl)pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1C(CCCCI)CCN1CCCCN1CCN(c2cccc3sccc23)CC1 |
| InChI | InChI=1S/C24H34IN3OS.ClH/c25-11-2-1-6-20-9-14-28(24(20)29)13-4-3-12-26-15-17-27(18-16-26)22-7-5-8-23-21(22)10-19-30-23;/h5,7-8,10,19-20H,1-4,6,9,11-18H2;1H |
| InChIKey | OUUVXRRWJQNSEE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.99 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|