C25H27N3O3S — CID 134391639
7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]-1-hydroxybutoxy]-1H-quinolin-2-one (PubChem CID 134391639) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]-1-hydroxybutoxy]-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]-1-hydroxybutoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 134391639 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]-1-hydroxybutoxy]-1H-quinolin-2-one |
| SMILES | O=c1ccc2ccc(OC(O)CCCN3CCN(c4cccc5sccc45)CC3)cc2[nH]1 |
| InChI | InChI=1S/C25H27N3O3S/c29-24-9-7-18-6-8-19(17-21(18)26-24)31-25(30)5-2-11-27-12-14-28(15-13-27)22-3-1-4-23-20(22)10-16-32-23/h1,3-4,6-10,16-17,25,30H,2,5,11-15H2,(H,26,29) |
| InChIKey | BJBGOJMUXNFJIH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|