C26H29N3OS — CID 126682543
7-[5-[4-(1-benzothiophen-4-yl)piperazin-1-yl]pentyl]-1H-quinolin-2-one (PubChem CID 126682543) has the molecular formula C26H29N3OS and a molecular weight of 431.61 g/mol. Its IUPAC name is 7-[5-[4-(1-benzothiophen-4-yl)piperazin-1-yl]pentyl]-1H-quinolin-2-one.
| Compound Name | 7-[5-[4-(1-benzothiophen-4-yl)piperazin-1-yl]pentyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 126682543 |
| Molecular Formula | C26H29N3OS |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 7-[5-[4-(1-benzothiophen-4-yl)piperazin-1-yl]pentyl]-1H-quinolin-2-one |
| SMILES | O=c1ccc2ccc(CCCCCN3CCN(c4cccc5sccc45)CC3)cc2[nH]1 |
| InChI | InChI=1S/C26H29N3OS/c30-26-11-10-21-9-8-20(19-23(21)27-26)5-2-1-3-13-28-14-16-29(17-15-28)24-6-4-7-25-22(24)12-18-31-25/h4,6-12,18-19H,1-3,5,13-17H2,(H,27,30) |
| InChIKey | FFIQSCOADWZDLK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|