C33H31N3O2S2 — CID 169434962
7-[4-[4-[2-(1-benzothiophen-4-yl)-1-benzothiophen-4-yl]piperazin-1-yl]butoxy]-1H-quinolin-2-one (PubChem CID 169434962) has the molecular formula C33H31N3O2S2 and a molecular weight of 565.76 g/mol. Its IUPAC name is 7-[4-[4-[2-(1-benzothiophen-4-yl)-1-benzothiophen-4-yl]piperazin-1-yl]butoxy]-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-[2-(1-benzothiophen-4-yl)-1-benzothiophen-4-yl]piperazin-1-yl]butoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 169434962 |
| Molecular Formula | C33H31N3O2S2 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 7-[4-[4-[2-(1-benzothiophen-4-yl)-1-benzothiophen-4-yl]piperazin-1-yl]butoxy]-1H-quinolin-2-one |
| SMILES | O=c1ccc2ccc(OCCCCN3CCN(c4cccc5sc(-c6cccc7sccc67)cc45)CC3)cc2[nH]1 |
| InChI | InChI=1S/C33H31N3O2S2/c37-33-12-10-23-9-11-24(21-28(23)34-33)38-19-2-1-14-35-15-17-36(18-16-35)29-6-4-8-31-27(29)22-32(40-31)25-5-3-7-30-26(25)13-20-39-30/h3-13,20-22H,1-2,14-19H2,(H,34,37) |
| InChIKey | VJMGPLYFEPJVMF-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|