C33H42N4O4S — CID 71295456
7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1H-quinolin-2-one;cyclohexylmethylcarbamic acid (PubChem CID 71295456) has the molecular formula C33H42N4O4S and a molecular weight of 590.79 g/mol. Its IUPAC name is 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1H-quinolin-2-one;cyclohexylmethylcarbamic acid.
| Compound Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1H-quinolin-2-one;cyclohexylmethylcarbamic acid |
|---|---|
| PubChem CID | 71295456 |
| Molecular Formula | C33H42N4O4S |
| Molecular Weight | 590.79 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1H-quinolin-2-one;cyclohexylmethylcarbamic acid |
| SMILES | O=C(O)NCC1CCCCC1.O=c1ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc2[nH]1 |
| InChI | InChI=1S/C25H27N3O2S.C8H15NO2/c29-25-9-7-19-6-8-20(18-22(19)26-25)30-16-2-1-11-27-12-14-28(15-13-27)23-4-3-5-24-21(23)10-17-31-24;10-8(11)9-6-7-4-2-1-3-5-7/h3-10,17-18H,1-2,11-16H2,(H,26,29);7,9H,1-6H2,(H,10,11) |
| InChIKey | PXYAEAWAEPWNRC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.79 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|