C24H29N3O3S — CID 67504747
4-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methoxy-5-methylbenzamide (PubChem CID 67504747) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 4-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methoxy-5-methylbenzamide.
| Compound Name | 4-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methoxy-5-methylbenzamide |
|---|---|
| PubChem CID | 67504747 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methoxy-5-methylbenzamide |
| SMILES | COc1cc(C(N)=O)cc(C)c1OCCCN1CCN(c2cccc3sccc23)CC1 |
| InChI | InChI=1S/C24H29N3O3S/c1-17-15-18(24(25)28)16-21(29-2)23(17)30-13-4-8-26-9-11-27(12-10-26)20-5-3-6-22-19(20)7-14-31-22/h3,5-7,14-16H,4,8-13H2,1-2H3,(H2,25,28) |
| InChIKey | XKMMSGHEBSEYSI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|