C26H29N3O5S — CID 57499618
2-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methoxy-5-(2-oxo-1,3-oxazolidin-3-yl)benzaldehyde (PubChem CID 57499618) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is 2-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methoxy-5-(2-oxo-1,3-oxazolidin-3-yl)benzaldehyde.
| Compound Name | 2-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methoxy-5-(2-oxo-1,3-oxazolidin-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 57499618 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-3-methoxy-5-(2-oxo-1,3-oxazolidin-3-yl)benzaldehyde |
| SMILES | COc1cc(N2CCOC2=O)cc(C=O)c1OCCCN1CCN(c2cccc3sccc23)CC1 |
| InChI | InChI=1S/C26H29N3O5S/c1-32-23-17-20(29-12-14-34-26(29)31)16-19(18-30)25(23)33-13-3-7-27-8-10-28(11-9-27)22-4-2-5-24-21(22)6-15-35-24/h2,4-6,15-18H,3,7-14H2,1H3 |
| InChIKey | XLIONUWZKVNPOB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|