C25H31N3O6S2 — CID 138558286
7-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-2-methyl-1,3-dihydroisoquinolin-4-one;sulfuric acid (PubChem CID 138558286) has the molecular formula C25H31N3O6S2 and a molecular weight of 533.67 g/mol. Its IUPAC name is 7-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-2-methyl-1,3-dihydroisoquinolin-4-one;sulfuric acid.
| Compound Name | 7-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-2-methyl-1,3-dihydroisoquinolin-4-one;sulfuric acid |
|---|---|
| PubChem CID | 138558286 |
| Molecular Formula | C25H31N3O6S2 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 7-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-2-methyl-1,3-dihydroisoquinolin-4-one;sulfuric acid |
| SMILES | CN1CC(=O)c2ccc(OCCCN3CCN(c4cccc5sccc45)CC3)cc2C1.O=S(=O)(O)O |
| InChI | InChI=1S/C25H29N3O2S.H2O4S/c1-26-17-19-16-20(6-7-21(19)24(29)18-26)30-14-3-9-27-10-12-28(13-11-27)23-4-2-5-25-22(23)8-15-31-25;1-5(2,3)4/h2,4-8,15-16H,3,9-14,17-18H2,1H3;(H2,1,2,3,4) |
| InChIKey | WTPIPRIFSNJMCU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|