C29H43ClN3OSSi — CID 162177594
CID 162177594 (PubChem CID 162177594) has the molecular formula C29H43ClN3OSSi and a molecular weight of 545.29 g/mol.
| Compound Name | CID 162177594 |
|---|---|
| PubChem CID | 162177594 |
| Molecular Formula | C29H43ClN3OSSi |
| Molecular Weight | 545.29 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)CC.Cl.c1cc(N2CCN(CCCOc3ccc4c(c3)CCN4)CC2)c2ccsc2c1 |
| InChI | InChI=1S/C23H27N3OS.C6H15Si.ClH/c1-3-22(20-8-16-28-23(20)4-1)26-13-11-25(12-14-26)10-2-15-27-19-5-6-21-18(17-19)7-9-24-21;1-4-7(5-2)6-3;/h1,3-6,8,16-17,24H,2,7,9-15H2;4-6H2,1-3H3;1H |
| InChIKey | KBVZHEMOGHEGFY-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.29 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|