C21H25N5O2S — CID 143420829
6-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-N-methylpyrimidine-4-carboxamide (PubChem CID 143420829) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 6-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-N-methylpyrimidine-4-carboxamide.
| Compound Name | 6-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-N-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143420829 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 6-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]-N-methylpyrimidine-4-carboxamide |
| SMILES | CNC(=O)c1cc(OCCCN2CCN(c3cccc4sccc34)CC2)ncn1 |
| InChI | InChI=1S/C21H25N5O2S/c1-22-21(27)17-14-20(24-15-23-17)28-12-3-7-25-8-10-26(11-9-25)18-4-2-5-19-16(18)6-13-29-19/h2,4-6,13-15H,3,7-12H2,1H3,(H,22,27) |
| InChIKey | ZULSEDOTAJFEAE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|