C25H30N4O2S — CID 69099474
3-acetamido-N-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]benzamide (PubChem CID 69099474) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is 3-acetamido-N-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]benzamide.
| Compound Name | 3-acetamido-N-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 69099474 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 3-acetamido-N-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butyl]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)NCCCCN2CCN(c3cccc4sccc34)CC2)c1 |
| InChI | InChI=1S/C25H30N4O2S/c1-19(30)27-21-7-4-6-20(18-21)25(31)26-11-2-3-12-28-13-15-29(16-14-28)23-8-5-9-24-22(23)10-17-32-24/h4-10,17-18H,2-3,11-16H2,1H3,(H,26,31)(H,27,30) |
| InChIKey | YIRJYSITFPSUEV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|