C27H33N5O3S — CID 166381996
3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylcarbamoylamino]-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 166381996) has the molecular formula C27H33N5O3S and a molecular weight of 507.66 g/mol. Its IUPAC name is 3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylcarbamoylamino]-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylcarbamoylamino]-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 166381996 |
| Molecular Formula | C27H33N5O3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylcarbamoylamino]-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)Nc2cccc(C(=O)NCc3cccs3)c2)CC1 |
| InChI | InChI=1S/C27H33N5O3S/c1-35-25-11-3-2-10-24(25)32-16-14-31(15-17-32)13-6-12-28-27(34)30-22-8-4-7-21(19-22)26(33)29-20-23-9-5-18-36-23/h2-5,7-11,18-19H,6,12-17,20H2,1H3,(H,29,33)(H2,28,30,34) |
| InChIKey | WLAJYPBKIHRROL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|