C31H39N5O2 — CID 59840365
1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3-[4-[3-(prop-1-en-2-ylamino)phenyl]phenyl]urea (PubChem CID 59840365) has the molecular formula C31H39N5O2 and a molecular weight of 513.69 g/mol. Its IUPAC name is 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3-[4-[3-(prop-1-en-2-ylamino)phenyl]phenyl]urea.
| Compound Name | 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3-[4-[3-(prop-1-en-2-ylamino)phenyl]phenyl]urea |
|---|---|
| PubChem CID | 59840365 |
| Molecular Formula | C31H39N5O2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3-[4-[3-(prop-1-en-2-ylamino)phenyl]phenyl]urea |
| SMILES | C=C(C)Nc1cccc(-c2ccc(NC(=O)NCCCCN3CCN(c4ccccc4OC)CC3)cc2)c1 |
| InChI | InChI=1S/C31H39N5O2/c1-24(2)33-28-10-8-9-26(23-28)25-13-15-27(16-14-25)34-31(37)32-17-6-7-18-35-19-21-36(22-20-35)29-11-4-5-12-30(29)38-3/h4-5,8-16,23,33H,1,6-7,17-22H2,2-3H3,(H2,32,34,37) |
| InChIKey | BCLHUIPPEOOLQO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|