C27H38N4O3 — CID 34249305
tert-butyl N-[3-[4-[4-(3-methylphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]carbamate (PubChem CID 34249305) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[4-(3-methylphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[4-(3-methylphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 34249305 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | tert-butyl N-[3-[4-[4-(3-methylphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]carbamate |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)c3cccc(NC(=O)OC(C)(C)C)c3)CC2)c1 |
| InChI | InChI=1S/C27H38N4O3/c1-21-9-7-12-24(19-21)31-17-15-30(16-18-31)14-6-5-13-28-25(32)22-10-8-11-23(20-22)29-26(33)34-27(2,3)4/h7-12,19-20H,5-6,13-18H2,1-4H3,(H,28,32)(H,29,33) |
| InChIKey | ZGKNVFRCJYBVEL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|