C28H31N3O5S — CID 89435243
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl 2-hydroxyacetate (PubChem CID 89435243) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl 2-hydroxyacetate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 89435243 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl 2-hydroxyacetate |
| SMILES | O=C(CO)OCOc1ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc2n1 |
| InChI | InChI=1S/C28H31N3O5S/c32-19-28(33)36-20-35-27-9-7-21-6-8-22(18-24(21)29-27)34-16-2-1-11-30-12-14-31(15-13-30)25-4-3-5-26-23(25)10-17-37-26/h3-10,17-18,32H,1-2,11-16,19-20H2 |
| InChIKey | YCOIXXSZUVESJX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|