C32H40N4O4S — CID 89435526
[7-[4-[4-(2,3-dihydro-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl piperidine-1-carboxylate (PubChem CID 89435526) has the molecular formula C32H40N4O4S and a molecular weight of 576.76 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dihydro-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl piperidine-1-carboxylate.
| Compound Name | [7-[4-[4-(2,3-dihydro-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89435526 |
| Molecular Formula | C32H40N4O4S |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | [7-[4-[4-(2,3-dihydro-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl piperidine-1-carboxylate |
| SMILES | O=C(OCOc1ccc2ccc(OCCCCN3CCN(c4cccc5c4CCS5)CC3)cc2n1)N1CCCCC1 |
| InChI | InChI=1S/C32H40N4O4S/c37-32(36-15-2-1-3-16-36)40-24-39-31-12-10-25-9-11-26(23-28(25)33-31)38-21-5-4-14-34-17-19-35(20-18-34)29-7-6-8-30-27(29)13-22-41-30/h6-12,23H,1-5,13-22,24H2 |
| InChIKey | UHVDKRGUDQMGGA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 67.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|