C28H34Cl2N4O3 — CID 66810503
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] N-tert-butylcarbamate (PubChem CID 66810503) has the molecular formula C28H34Cl2N4O3 and a molecular weight of 545.51 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] N-tert-butylcarbamate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 66810503 |
| Molecular Formula | C28H34Cl2N4O3 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2n1 |
| InChI | InChI=1S/C28H34Cl2N4O3/c1-28(2,3)32-27(35)37-25-12-10-20-9-11-21(19-23(20)31-25)36-18-5-4-13-33-14-16-34(17-15-33)24-8-6-7-22(29)26(24)30/h6-12,19H,4-5,13-18H2,1-3H3,(H,32,35) |
| InChIKey | PYZGPKDHLWUPMK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|