C32H42Cl2N4O4 — CID 91333896
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl N-(2,4-dimethylpentyl)carbamate (PubChem CID 91333896) has the molecular formula C32H42Cl2N4O4 and a molecular weight of 617.62 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl N-(2,4-dimethylpentyl)carbamate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl N-(2,4-dimethylpentyl)carbamate |
|---|---|
| PubChem CID | 91333896 |
| Molecular Formula | C32H42Cl2N4O4 |
| Molecular Weight | 617.62 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl]oxymethyl N-(2,4-dimethylpentyl)carbamate |
| SMILES | CC(C)CC(C)CNC(=O)OCOc1ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2n1 |
| InChI | InChI=1S/C32H42Cl2N4O4/c1-23(2)19-24(3)21-35-32(39)42-22-41-30-12-10-25-9-11-26(20-28(25)36-30)40-18-5-4-13-37-14-16-38(17-15-37)29-8-6-7-27(33)31(29)34/h6-12,20,23-24H,4-5,13-19,21-22H2,1-3H3,(H,35,39) |
| InChIKey | SYRXYCDMGZSZDZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.62 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|