C33H43Cl2N3O3 — CID 126658864
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] 3,3,5,5-tetramethylhexanoate (PubChem CID 126658864) has the molecular formula C33H43Cl2N3O3 and a molecular weight of 600.63 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] 3,3,5,5-tetramethylhexanoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] 3,3,5,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 126658864 |
| Molecular Formula | C33H43Cl2N3O3 |
| Molecular Weight | 600.63 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]quinolin-2-yl] 3,3,5,5-tetramethylhexanoate |
| SMILES | CC(C)(C)CC(C)(C)CC(=O)Oc1ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2n1 |
| InChI | InChI=1S/C33H43Cl2N3O3/c1-32(2,3)23-33(4,5)22-30(39)41-29-14-12-24-11-13-25(21-27(24)36-29)40-20-7-6-15-37-16-18-38(19-17-37)28-10-8-9-26(34)31(28)35/h8-14,21H,6-7,15-20,22-23H2,1-5H3 |
| InChIKey | CGQAPIQLCDZLKP-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.63 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|