C30H35Cl2N3O4 — CID 58096803
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl cyclopentanecarboxylate (PubChem CID 58096803) has the molecular formula C30H35Cl2N3O4 and a molecular weight of 572.53 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl cyclopentanecarboxylate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 58096803 |
| Molecular Formula | C30H35Cl2N3O4 |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl cyclopentanecarboxylate |
| SMILES | O=C(OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21)C1CCCC1 |
| InChI | InChI=1S/C30H35Cl2N3O4/c31-25-8-5-9-26(29(25)32)34-17-15-33(16-18-34)14-3-4-19-38-24-12-10-22-11-13-28(36)35(27(22)20-24)21-39-30(37)23-6-1-2-7-23/h5,8-13,20,23H,1-4,6-7,14-19,21H2 |
| InChIKey | ABKZEXKIHBKSOH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|