C29H37Cl2N3O6 — CID 134425062
7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1-[[1-hydroxy-2-(2-methoxyethoxy)ethoxy]methyl]quinolin-2-one (PubChem CID 134425062) has the molecular formula C29H37Cl2N3O6 and a molecular weight of 594.54 g/mol. Its IUPAC name is 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1-[[1-hydroxy-2-(2-methoxyethoxy)ethoxy]methyl]quinolin-2-one.
| Compound Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1-[[1-hydroxy-2-(2-methoxyethoxy)ethoxy]methyl]quinolin-2-one |
|---|---|
| PubChem CID | 134425062 |
| Molecular Formula | C29H37Cl2N3O6 |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1-[[1-hydroxy-2-(2-methoxyethoxy)ethoxy]methyl]quinolin-2-one |
| SMILES | COCCOCC(O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C29H37Cl2N3O6/c1-37-17-18-38-20-28(36)40-21-34-26-19-23(9-7-22(26)8-10-27(34)35)39-16-3-2-11-32-12-14-33(15-13-32)25-6-4-5-24(30)29(25)31/h4-10,19,28,36H,2-3,11-18,20-21H2,1H3 |
| InChIKey | BSMLEKXULGGFJC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|