C27H34Cl2N3O6P — CID 58096443
[1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-2-methylpropyl] dihydrogen phosphate (PubChem CID 58096443) has the molecular formula C27H34Cl2N3O6P and a molecular weight of 598.46 g/mol. Its IUPAC name is [1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-2-methylpropyl] dihydrogen phosphate.
| Compound Name | [1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-2-methylpropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58096443 |
| Molecular Formula | C27H34Cl2N3O6P |
| Molecular Weight | 598.46 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | [1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-2-methylpropyl] dihydrogen phosphate |
| SMILES | CC(C)C(OP(=O)(O)O)n1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C27H34Cl2N3O6P/c1-19(2)27(38-39(34,35)36)32-24-18-21(10-8-20(24)9-11-25(32)33)37-17-4-3-12-30-13-15-31(16-14-30)23-7-5-6-22(28)26(23)29/h5-11,18-19,27H,3-4,12-17H2,1-2H3,(H2,34,35,36) |
| InChIKey | CLYWLKJVMYJIAT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|