C26H29Cl2N3O4S — CID 129274117
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl methylsulfanylformate (PubChem CID 129274117) has the molecular formula C26H29Cl2N3O4S and a molecular weight of 550.51 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl methylsulfanylformate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl methylsulfanylformate |
|---|---|
| PubChem CID | 129274117 |
| Molecular Formula | C26H29Cl2N3O4S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl methylsulfanylformate |
| SMILES | CSC(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C26H29Cl2N3O4S/c1-36-26(33)35-18-31-23-17-20(9-7-19(23)8-10-24(31)32)34-16-3-2-11-29-12-14-30(15-13-29)22-6-4-5-21(27)25(22)28/h4-10,17H,2-3,11-16,18H2,1H3 |
| InChIKey | OUNOOKJUZOPKKO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|