C35H48Cl2N4O4 — CID 118296668
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl N-methyl-N-nonylcarbamate (PubChem CID 118296668) has the molecular formula C35H48Cl2N4O4 and a molecular weight of 659.70 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl N-methyl-N-nonylcarbamate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl N-methyl-N-nonylcarbamate |
|---|---|
| PubChem CID | 118296668 |
| Molecular Formula | C35H48Cl2N4O4 |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl N-methyl-N-nonylcarbamate |
| SMILES | CCCCCCCCCN(C)C(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C35H48Cl2N4O4/c1-3-4-5-6-7-8-9-19-38(2)35(43)45-27-41-32-26-29(17-15-28(32)16-18-33(41)42)44-25-11-10-20-39-21-23-40(24-22-39)31-14-12-13-30(36)34(31)37/h12-18,26H,3-11,19-25,27H2,1-2H3 |
| InChIKey | BXVVTGIESAJNFJ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 67.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|