C38H38Cl2N4O3 — CID 58579123
N,N-dibenzyl-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinoline-1-carboxamide (PubChem CID 58579123) has the molecular formula C38H38Cl2N4O3 and a molecular weight of 669.65 g/mol. Its IUPAC name is N,N-dibenzyl-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinoline-1-carboxamide.
| Compound Name | N,N-dibenzyl-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 58579123 |
| Molecular Formula | C38H38Cl2N4O3 |
| Molecular Weight | 669.65 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | N,N-dibenzyl-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxoquinoline-1-carboxamide |
| SMILES | O=C(N(Cc1ccccc1)Cc1ccccc1)n1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C38H38Cl2N4O3/c39-33-14-9-15-34(37(33)40)42-23-21-41(22-24-42)20-7-8-25-47-32-18-16-31-17-19-36(45)44(35(31)26-32)38(46)43(27-29-10-3-1-4-11-29)28-30-12-5-2-6-13-30/h1-6,9-19,26H,7-8,20-25,27-28H2 |
| InChIKey | GMHJZBUQOAXCMK-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 58.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.65 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|